CAS 89446-53-7
:7-Bromo-2-methoxy-4-methylquinoline
Description:
7-Bromo-2-methoxy-4-methylquinoline is an organic compound belonging to the quinoline family, characterized by a fused bicyclic structure containing a benzene ring and a pyridine ring. This compound features a bromine atom at the 7-position, a methoxy group (-OCH₃) at the 2-position, and a methyl group (-CH₃) at the 4-position of the quinoline ring. The presence of these substituents influences its chemical reactivity and physical properties, such as solubility and boiling point. Typically, compounds like this exhibit biological activity, making them of interest in medicinal chemistry and drug development. The bromine atom can enhance the compound's reactivity, while the methoxy and methyl groups can affect its electronic properties and steric hindrance. Additionally, 7-Bromo-2-methoxy-4-methylquinoline may exhibit fluorescence, which can be useful in various analytical applications. As with many organic compounds, safety data should be consulted for handling and usage, as well as potential environmental impacts.
Formula:C11H10BrNO
InChI:InChI=1S/C11H10BrNO/c1-7-5-11(14-2)13-10-6-8(12)3-4-9(7)10/h3-6H,1-2H3
InChI key:InChIKey=CIGLFVWFRKNNSC-UHFFFAOYSA-N
SMILES:CC=1C2=C(N=C(OC)C1)C=C(Br)C=C2
Synonyms:- 7-Bromo-2-methoxy-4-methylquinoline
- Quinoline, 7-bromo-2-methoxy-4-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
