CymitQuimica logo

CAS 89446-58-2

:

2,4-Diamino-5-(bromomethyl)pyrimidine

Description:
2,4-Diamino-5-(bromomethyl)pyrimidine is a heterocyclic organic compound characterized by its pyrimidine ring structure, which contains two amino groups at the 2 and 4 positions and a bromomethyl group at the 5 position. This compound is typically a solid at room temperature and is soluble in polar solvents due to the presence of amino groups, which can engage in hydrogen bonding. The bromomethyl substituent introduces a reactive site, making it useful in various chemical reactions, including nucleophilic substitutions. The presence of amino groups suggests potential applications in pharmaceuticals, particularly in the synthesis of biologically active compounds. Additionally, the compound may exhibit properties such as antimicrobial or antitumor activity, which are common in pyrimidine derivatives. Its molecular structure allows for various modifications, making it a versatile intermediate in organic synthesis. Safety data should be consulted for handling, as brominated compounds can pose health risks. Overall, 2,4-Diamino-5-(bromomethyl)pyrimidine is an important compound in medicinal chemistry and organic synthesis.
Formula:C5H9Br3N4
InChI:InChI=1/C5H7BrN4.2BrH/c6-1-3-2-9-5(8)10-4(3)7;;/h2H,1H2,(H4,7,8,9,10);2*1H
SMILES:C(c1c[nH]c(=N)[nH]c1=N)Br.Br.Br
Synonyms:
  • 5-(Bromomethyl)-2,4-pyrimidinediamine
  • 5-(Bromomethyl)Pyrimidine-2,4-Diamine
  • 5-(Bromomethyl)Pyrimidine-2,4-Diamine Dihydrobromide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.