CAS 89446-68-4
:7-(Trifluoromethyl)-4-quinolinecarboxaldehyde
Description:
7-(Trifluoromethyl)-4-quinolinecarboxaldehyde is a chemical compound characterized by its quinoline structure, which consists of a fused bicyclic system containing a benzene ring and a pyridine ring. The presence of a trifluoromethyl group (-CF3) at the 7-position significantly influences its electronic properties, enhancing its lipophilicity and potentially its reactivity. The aldehyde functional group (-CHO) at the 4-position contributes to its reactivity, making it a useful intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. This compound is typically a pale yellow to brown solid and is sparingly soluble in water but soluble in organic solvents. Its unique structural features allow it to participate in various chemical reactions, including nucleophilic additions and condensation reactions. Additionally, the trifluoromethyl group can impart unique biological activities, making this compound of interest in medicinal chemistry. Safety data should be consulted, as compounds containing trifluoromethyl groups can exhibit toxicity and environmental persistence.
Formula:C11H6F3NO
InChI:InChI=1S/C11H6F3NO/c12-11(13,14)8-1-2-9-7(6-16)3-4-15-10(9)5-8/h1-6H
InChI key:InChIKey=APCJAFSZYJPDTK-UHFFFAOYSA-N
SMILES:C(=O)C=1C2=C(C=C(C(F)(F)F)C=C2)N=CC1
Synonyms:- 4-Quinolinecarboxaldehyde, 7-(trifluoromethyl)-
- 7-(Trifluoromethyl)-4-quinolinecarboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
