
CAS 89450-30-6
:1-Butanaminium, N-[bis(diethylamino)methylene]-N-butyl-, chloride (1:1)
Description:
1-Butanaminium, N-[bis(diethylamino)methylene]-N-butyl-, chloride (1:1), with CAS number 89450-30-6, is a quaternary ammonium compound characterized by its cationic nature due to the presence of a positively charged nitrogen atom. This substance features a butyl group and two diethylamino groups attached to the nitrogen, contributing to its lipophilicity and potential surfactant properties. The chloride ion serves as the counterion, balancing the charge of the ammonium cation. Typically, quaternary ammonium compounds exhibit antimicrobial properties, making them useful in various applications, including disinfectants and antiseptics. Additionally, they may possess solubilizing and emulsifying capabilities, which can be advantageous in formulations for pharmaceuticals and cosmetics. The structure of this compound suggests it may interact with biological membranes, influencing its bioactivity. Overall, its unique combination of functional groups and ionic characteristics makes it a compound of interest in both industrial and research settings.
Formula:C17H38N3·Cl
InChI:InChI=1S/C17H38N3.ClH/c1-7-13-15-20(16-14-8-2)17(18(9-3)10-4)19(11-5)12-6;/h7-16H2,1-6H3;1H/q+1;/p-1
InChI key:InChIKey=ZBOHREJNHNIBPL-UHFFFAOYSA-M
SMILES:C(=[N+](CCCC)CCCC)(N(CC)CC)N(CC)CC.[Cl-]
Synonyms:- 1-Butanaminium, N-[bis(diethylamino)methylene]-N-butyl-, chloride
- 1-Butanaminium, N-[bis(diethylamino)methylene]-N-butyl-, chloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-Butanaminium, N-[bis(diethylamino)methylene]-N-butyl-, chloride
CAS:Formula:C17H38ClN3Molecular weight:319.9567
