CAS 89457-52-3
:3-Hydroxy-1-methylpropyl nonanoate
Description:
3-Hydroxy-1-methylpropyl nonanoate, with the CAS number 89457-52-3, is an ester compound characterized by its functional groups and molecular structure. It features a nonanoate moiety, which is derived from nonanoic acid, indicating that it has a long hydrophobic carbon chain, contributing to its potential applications in various fields, including cosmetics and food additives. The presence of a hydroxy group suggests that it may exhibit some degree of polarity, which can influence its solubility in different solvents. This compound is likely to have a moderate boiling point and melting point, typical of esters, and may possess a pleasant, fruity odor, making it suitable for use in fragrances. Additionally, its structure implies that it could participate in various chemical reactions, such as esterification or hydrolysis, under appropriate conditions. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance. Overall, 3-Hydroxy-1-methylpropyl nonanoate is a versatile compound with potential applications in multiple industries.
Formula:C13H26O3
InChI:InChI=1S/C13H26O3/c1-3-4-5-6-7-8-9-13(15)16-12(2)10-11-14/h12,14H,3-11H2,1-2H3
InChI key:InChIKey=ODCLBFHKYXZZSM-UHFFFAOYSA-N
SMILES:C(OC(CCO)C)(CCCCCCCC)=O
Synonyms:- 3-Hydroxy-1-methylpropyl nonanoate
- Nonanoic acid, 3-hydroxy-1-methylpropyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
