CAS 89458-64-0
:4-methylpent-4-en-2-one - furan-2,5-dione (1:1)
Description:
4-Methylpent-4-en-2-one and furan-2,5-dione in a 1:1 ratio represent a chemical compound that combines features of both components. 4-Methylpent-4-en-2-one is a ketone characterized by a double bond and a methyl group, contributing to its reactivity and potential applications in organic synthesis. It typically exhibits a pleasant odor and is used in various chemical reactions, including Michael additions and as a building block in the synthesis of more complex molecules. Furan-2,5-dione, also known as maleic anhydride, is a cyclic anhydride that is highly reactive, particularly in Diels-Alder reactions and as a precursor for various polymers and fine chemicals. The combination of these two substances may lead to unique properties, such as enhanced reactivity or specific functional characteristics, making it of interest in fields like materials science and medicinal chemistry. The compound's behavior, stability, and reactivity would depend on the specific conditions under which it is used, including temperature, solvent, and the presence of catalysts.
Formula:C10H12O4
InChI:InChI=1/C6H10O.C4H2O3/c1-5(2)4-6(3)7;5-3-1-2-4(6)7-3/h1,4H2,2-3H3;1-2H
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
