CymitQuimica logo

CAS 89459-10-9

:

9-amino-N-[2-(dimethylamino)ethyl]-5-methylacridine-4-carboxamide dihydrochloride

Description:
9-amino-N-[2-(dimethylamino)ethyl]-5-methylacridine-4-carboxamide dihydrochloride is a chemical compound characterized by its complex structure, which includes an acridine core substituted with an amino group and a carboxamide functional group. This compound is typically a white to off-white solid and is soluble in water due to the presence of the dihydrochloride salt form, which enhances its solubility and stability. The dimethylamino group contributes to its basicity, making it potentially useful in various biochemical applications, including as a fluorescent probe or in drug development. Its acridine structure is known for intercalating into DNA, which may impart biological activity relevant to cancer research or antimicrobial properties. As with many acridine derivatives, it may exhibit photophysical properties that are valuable in analytical chemistry. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity and reactivity.
Formula:C19H24Cl2N4O
InChI:InChI=1/C19H22N4O.2ClH/c1-12-6-4-7-13-16(20)14-8-5-9-15(18(14)22-17(12)13)19(24)21-10-11-23(2)3;;/h4-9H,10-11H2,1-3H3,(H2,20,22)(H,21,24);2*1H
Synonyms:
  • Acridine-4-carboxamide, 9-amino-5-methyl- N-[2-(dimethylamino)ethyl]-, dihydrochloride
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.