CAS 89459-15-4
:9-amino-N-[2-(dimethylamino)ethyl]-6-methylacridine-4-carboxamide dihydrochloride
Description:
9-amino-N-[2-(dimethylamino)ethyl]-6-methylacridine-4-carboxamide dihydrochloride is a chemical compound characterized by its complex structure, which includes an acridine core substituted with an amino group and a carboxamide functional group. This compound is typically a crystalline solid and is soluble in water due to the presence of the dihydrochloride salt form, which enhances its solubility and stability. The dimethylamino group contributes to its basicity, making it a potential candidate for various biological applications, including as a fluorescent probe or in medicinal chemistry. The acridine moiety is known for its intercalating properties, which can influence DNA interactions, making this compound of interest in the fields of biochemistry and pharmacology. Its specific properties, such as melting point, spectral data, and reactivity, would depend on the conditions under which it is studied. Overall, this compound represents a unique combination of structural features that may confer interesting biological activities.
Formula:C19H24Cl2N4O
InChI:InChI=1/C19H22N4O.2ClH/c1-12-7-8-13-16(11-12)22-18-14(17(13)20)5-4-6-15(18)19(24)21-9-10-23(2)3;;/h4-8,11H,9-10H2,1-3H3,(H2,20,22)(H,21,24);2*1H
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-Acridinecarboxamide,9-amino-N-[2-(dimethylamino)ethyl]-6-methyl-, hydrochloride (1:2)
CAS:Formula:C19H24Cl2N4OMolecular weight:395.3261
