![N-[2-(Dimethylamino)ethyl]acridine-4-carboxamide](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fcas-image%2Fthumb-webp%2F318876-n-2-dimethylamino-ethyl-acridine-4-carboxamide.webp&w=3840&q=75)
CAS 89459-25-6
:N-[2-(Dimethylamino)ethyl]acridine-4-carboxamide
Description:
N-[2-(Dimethylamino)ethyl]acridine-4-carboxamide, with the CAS number 89459-25-6, is a chemical compound characterized by its acridine backbone, which is a polycyclic aromatic structure known for its fluorescent properties. This compound features a dimethylaminoethyl side chain that enhances its solubility and biological activity. It typically exhibits properties such as moderate to high lipophilicity due to the aromatic system, which can influence its interaction with biological membranes. The presence of the carboxamide functional group contributes to its potential as a ligand in various biochemical applications. This compound may also display fluorescence, making it useful in imaging and labeling applications in biological research. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. However, detailed studies on its pharmacokinetics, toxicity, and specific biological activities would be necessary to fully understand its utility in various fields.
Formula:C18H19N3O
InChI:InChI=1S/C18H19N3O/c1-21(2)11-10-19-18(22)15-8-5-7-14-12-13-6-3-4-9-16(13)20-17(14)15/h3-9,12H,10-11H2,1-2H3,(H,19,22)
InChI key:InChIKey=XBGNERSKEKDZDS-UHFFFAOYSA-N
SMILES:C(NCCN(C)C)(=O)C=1C2=C(C=C3C(=N2)C=CC=C3)C=CC1
Synonyms:- 4-acridinecarboxamide, N-[2-(dimethylamino)ethyl]-
- N-[2-(Dimethylamino)ethyl]-4-acridinecarboxamide
- NSC 601316
- N-[2-(Dimethylamino)ethyl]acridine-4-carboxamide
- DACA
