CAS 89459-26-7

2-[[2-(Methoxycarbonyl)phenyl]amino]-5-nitrobenzoic acid

Description:

2-[[2-(Methoxycarbonyl)phenyl]amino]-5-nitrobenzoic acid, with the CAS number 89459-26-7, is an organic compound characterized by its complex structure that includes both amino and nitro functional groups. This compound features a benzoic acid moiety, which contributes to its acidic properties, and a methoxycarbonyl group that enhances its solubility in organic solvents. The presence of the nitro group introduces significant electron-withdrawing characteristics, which can influence the compound's reactivity and stability. Typically, such compounds are of interest in medicinal chemistry and materials science due to their potential biological activity and utility in synthesizing other chemical entities. The compound may exhibit various physical properties, including melting point and solubility, which are influenced by its molecular structure. Additionally, it may participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions, making it a valuable intermediate in organic synthesis. Overall, this compound's unique functional groups and structural features make it a subject of interest for further research and application in various chemical fields.

Formula: C₁₅H₁₂N₂O₆

InChI: InChI=1S/C15H12N2O6/c1-23-15(20)10-4-2-3-5-12(10)16-13-7-6-9(17(21)22)8-11(13)14(18)19/h2-8,16H,1H3,(H,18,19)

InChI key: InChIKey=ZFUBVVAONYKTRD-UHFFFAOYSA-N

SMILES: N(C1=C(C(O)=O)C=C(N(=O)=O)C=C1)C2=C(C(OC)=O)C=CC=C2

Synonyms:

• Benzoic acid, 2-[[2-(methoxycarbonyl)phenyl]amino]-5-nitro-
• 2-[[2-(Methoxycarbonyl)phenyl]amino]-5-nitrobenzoic acid

Benzoic acid, 2-[[2-(methoxycarbonyl)phenyl]amino]-5-nitro-

CAS: 89459-26-7

Formula: C₁₅H₁₂N₂O₆

Molecular weight: 316.2656

Ref: IN-DA0042FJ