CymitQuimica logo

CAS 89459-33-6

:

N-[2-(dimethylamino)ethyl]-9-methylacridine-4-carboxamide

Description:
N-[2-(dimethylamino)ethyl]-9-methylacridine-4-carboxamide, with the CAS number 89459-33-6, is a chemical compound that belongs to the class of acridine derivatives. This substance features a complex structure characterized by an acridine core, which is a polycyclic aromatic compound known for its fluorescent properties. The presence of a dimethylaminoethyl side chain enhances its solubility and potential biological activity, making it of interest in medicinal chemistry. The carboxamide functional group contributes to its polar characteristics, which can influence its interaction with biological systems. This compound may exhibit properties such as fluorescence, which can be utilized in various applications, including as a fluorescent probe in biochemical assays. Additionally, due to its structural features, it may have implications in drug design, particularly in targeting specific biological pathways. However, detailed studies on its pharmacological properties, toxicity, and specific applications would be necessary to fully understand its potential uses in research and medicine.
Formula:C19H21N3O
InChI:InChI=1/C19H21N3O/c1-13-14-7-4-5-10-17(14)21-18-15(13)8-6-9-16(18)19(23)20-11-12-22(2)3/h4-10H,11-12H2,1-3H3,(H,20,23)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.