CAS 89459-38-1
:Benzoic acid, 2-iodo-4-nitro-
Description:
Benzoic acid, 2-iodo-4-nitro- (CAS 89459-38-1) is an aromatic carboxylic acid characterized by the presence of both an iodine and a nitro group on the benzene ring. This compound features a benzoic acid backbone, which contributes to its acidic properties, allowing it to dissociate in solution to release hydrogen ions. The iodine substituent at the 2-position and the nitro group at the 4-position influence its reactivity and polarity, making it a useful intermediate in organic synthesis. The presence of the nitro group typically enhances the electrophilicity of the aromatic ring, facilitating further chemical reactions such as electrophilic aromatic substitution. Additionally, the compound may exhibit unique physical properties, including solubility in organic solvents and varying melting and boiling points, influenced by the substituents' electronic effects. Overall, 2-iodo-4-nitrobenzoic acid serves as a valuable compound in chemical research and applications, particularly in the synthesis of pharmaceuticals and agrochemicals.
Formula:C7H4INO4
InChI:InChI=1S/C7H4INO4/c8-6-3-4(9(12)13)1-2-5(6)7(10)11/h1-3H,(H,10,11)
InChI key:SQICTGFCQITYDT-UHFFFAOYSA-N
SMILES:C1=CC(=C(C=C1[N+](=O)[O-])I)C(=O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Iodo-4-nitrobenzoic acid
CAS:2-Iodo-4-nitrobenzoic acidFormula:C7H4INO4Purity:95%Color and Shape:Yellow Solid-PowderMolecular weight:293.015422-Iodo-4-Nitrobenzoic Acid
CAS:Formula:C7H4INO4Purity:97%Color and Shape:SolidMolecular weight:293.01542-Iodo-4-nitrobenzoic acid
CAS:2-Iodo-4-nitrobenzoic acidFormula:C7H4INO4Purity:98%Molecular weight:293.022-Iodo-4-nitrobenzoic acid
CAS:Formula:C7H4INO4Purity:95%Color and Shape:SolidMolecular weight:293.0162-iodo-4-nitrobenzoic acid
CAS:2-Iodo-4-nitrobenzoic acid is a synthetic heterocyclic compound with the molecular formula C6H3INO2Cl. It has a picric pharmacophore, which is a structural motif that consists of a trifluoromethyl group and two nitro groups. 2-Iodo-4-nitrobenzoic acid is insoluble in water and hydrochloric acid. It can be synthesized by reacting diphenylmethane with sodium hydroxide solution and then adding hydrochloric acid to the resultant solution. The chemical structure of 2-iodo-4-nitrobenzoic acid appears as an orange crystalline solid in its pure form, but it has not been observed to have any biological activity. The chemical shifts for the methyl protons are between 1.5 and 4 ppm, and the chemical shifts for the hydrogen protons are between 2 and 4 ppm in its nmr spectra.Formula:C7H4INO4Purity:Min. 95%Molecular weight:293 g/mol




