
CAS 89460-13-9
:6-Octen-1-ol, 3,7-dimethyl-, propanoate, (S)-
Description:
6-Octen-1-ol, 3,7-dimethyl-, propanoate, (S)-, is an organic compound characterized by its ester functional group, which is derived from the reaction of 6-octen-1-ol and propanoic acid. This compound features a long carbon chain, contributing to its hydrophobic nature, while the presence of the alcohol and ester groups provides it with polar characteristics. The (S)- designation indicates that it has a specific stereochemistry, which can influence its biological activity and interactions. Typically, such compounds are found in various natural sources and may exhibit pleasant, fruity aromas, making them relevant in the flavor and fragrance industries. Additionally, they may possess potential applications in pharmaceuticals or as intermediates in organic synthesis. The compound's molecular structure suggests it may have moderate volatility and solubility in organic solvents, while being less soluble in water due to its hydrophobic carbon chain. Overall, 6-Octen-1-ol, 3,7-dimethyl-, propanoate, (S)- is a versatile compound with various potential applications in different fields.
Formula:C13H24O2
InChI:InChI=1S/C13H24O2/c1-5-13(14)15-10-9-12(4)8-6-7-11(2)3/h7,12H,5-6,8-10H2,1-4H3/t12-/m0/s1
InChI key:InChIKey=POPNTVRHTZDEBW-LBPRGKRZSA-N
SMILES:[C@@H](CCOC(CC)=O)(CCC=C(C)C)C
Synonyms:- 6-Octen-1-ol, 3,7-dimethyl-, propanoate, (S)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
