CAS 89464-79-9

5,6-Dimethyl-4-pyridazinamine

Description:

5,6-Dimethyl-4-pyridazinamine is an organic compound characterized by its pyridazine ring, which is a six-membered aromatic heterocycle containing two nitrogen atoms at positions 1 and 2. The presence of two methyl groups at positions 5 and 6 contributes to its structural complexity and can influence its chemical reactivity and physical properties. This compound is typically a solid at room temperature and may exhibit properties such as solubility in polar solvents, depending on the specific functional groups present. It is often studied for its potential applications in pharmaceuticals and agrochemicals due to its nitrogen-containing heterocyclic structure, which is common in biologically active compounds. The CAS number 89464-79-9 uniquely identifies this substance in chemical databases, facilitating its recognition and study in scientific literature. As with many nitrogen-containing compounds, it may exhibit basic properties and can participate in various chemical reactions, including nucleophilic substitutions and complexation with metal ions. Safety data should be consulted for handling and usage, as with all chemical substances.

Formula: C₆H₉N₃

InChI: InChI=1S/C6H9N3/c1-4-5(2)9-8-3-6(4)7/h3H,1-2H3,(H2,7,9)

InChI key: InChIKey=RWWAAXOVCSYNNI-UHFFFAOYSA-N

SMILES: CC=1C(N)=CN=NC1C

Synonyms:

• 4-Pyridazinamine, 5,6-dimethyl-
• Pyridazine, 5-amino-3,4-dimethyl-
• 5,6-Dimethyl-4-pyridazinamine