CymitQuimica logo

CAS 89465-42-9

:

6-(ethylsulfanyl)pyridazin-3-amine

Description:
6-(Ethylsulfanyl)pyridazin-3-amine is a chemical compound characterized by its pyridazine core, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 2. The presence of an ethylsulfanyl group at the 6-position contributes to its unique properties, including potential reactivity and solubility characteristics. The amino group at the 3-position enhances its ability to participate in hydrogen bonding and may influence its biological activity. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in targeting specific biological pathways. Additionally, the compound's stability, solubility, and reactivity can be influenced by the substituents on the pyridazine ring, which may affect its interactions with other molecules. Overall, 6-(ethylsulfanyl)pyridazin-3-amine represents a class of compounds that could be explored for their therapeutic potential and chemical versatility.
Formula:C6H9N3S
InChI:InChI=1/C6H9N3S/c1-2-10-6-4-3-5(7)8-9-6/h3-4H,2H2,1H3,(H2,7,8)
SMILES:CCSc1ccc(=N)[nH]n1
Synonyms:
  • 3-Pyridazinamine, 6-(Ethylthio)-
  • 6-(Ethylsulfanyl)-3-pyridazinamine
  • 6-(Ethylsulfanyl)pyridazin-3-amin
  • 6-(Ethylsulfanyl)pyridazin-3-amine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.