CymitQuimica logo

CAS 89465-44-1

:

4-methyl-6-(methylsulfanyl)pyrimidin-5-amine

Description:
4-Methyl-6-(methylsulfanyl)pyrimidin-5-amine, with the CAS number 89465-44-1, is a heterocyclic organic compound featuring a pyrimidine ring, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. This compound is characterized by the presence of a methyl group at the 4-position and a methylthio group at the 6-position, along with an amino group at the 5-position of the pyrimidine ring. These functional groups contribute to its chemical reactivity and potential biological activity. The methylthio group can enhance lipophilicity, influencing the compound's solubility and permeability in biological systems. Additionally, the amino group can participate in hydrogen bonding, making the compound potentially useful in medicinal chemistry as a building block for pharmaceuticals. The compound's structural features suggest it may exhibit various pharmacological properties, although specific biological activities would require further investigation. Overall, 4-methyl-6-(methylsulfanyl)pyrimidin-5-amine represents a versatile scaffold in organic synthesis and drug development.
Formula:C6H9N3S
InChI:InChI=1/C6H9N3S/c1-4-5(7)6(10-2)9-3-8-4/h3H,7H2,1-2H3
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.