CymitQuimica logo

CAS 89465-63-4

:

4-[(ethylcarbamoyl)amino]-1,2,5-thiadiazole-3-carboxamide

Description:
4-[(Ethylcarbamoyl)amino]-1,2,5-thiadiazole-3-carboxamide, with the CAS number 89465-63-4, is a chemical compound characterized by its unique structure that includes a thiadiazole ring, which is a five-membered heterocyclic compound containing sulfur and nitrogen atoms. This compound features an ethylcarbamoyl group and an amide functional group, contributing to its potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carboxamide group. The thiadiazole moiety is known for its diverse pharmacological properties, including antimicrobial and anti-inflammatory activities. The compound's specific reactivity and stability can be influenced by the substituents on the thiadiazole ring and the overall molecular structure. As with many organic compounds, it is essential to handle it with care, following appropriate safety protocols, as it may have specific toxicity or environmental considerations. Further studies may be required to fully elucidate its properties and potential applications in pharmaceuticals or agrochemicals.
Formula:C6H9N5O2S
InChI:InChI=1/C6H9N5O2S/c1-2-8-6(13)9-5-3(4(7)12)10-14-11-5/h2H2,1H3,(H2,7,12)(H2,8,9,11,13)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.