CAS 89465-99-6

2-Bromo-3,4,6-trichlorobenzenamine

Description:

2-Bromo-3,4,6-trichlorobenzenamine, with the CAS number 89465-99-6, is an organic compound characterized by its complex halogenated aromatic structure. It features a benzene ring substituted with three chlorine atoms and one bromine atom, along with an amino group (-NH2) that enhances its reactivity. This compound is typically a solid at room temperature and may exhibit a range of colors depending on its purity and specific structural arrangement. The presence of multiple halogen substituents contributes to its potential applications in various fields, including pharmaceuticals, agrochemicals, and materials science. Its reactivity can be influenced by the electron-withdrawing nature of the halogens, making it a candidate for further chemical transformations. Additionally, the compound's solubility and stability can vary based on the solvent used and environmental conditions. Safety considerations are important when handling this substance, as halogenated compounds can pose health risks and environmental concerns. Proper storage and disposal methods should be followed to mitigate any potential hazards.

Formula: C₆H₃BrCl₃N

InChI: InChI=1S/C6H3BrCl3N/c7-4-5(10)2(8)1-3(9)6(4)11/h1H,11H2

InChI key: InChIKey=RMGNBGBWXYMMCG-UHFFFAOYSA-N

SMILES: ClC1=C(Br)C(N)=C(Cl)C=C1Cl

Synonyms:

• 2-Bromo-3,4,6-trichloroaniline
• Benzenamine, 2-bromo-3,4,6-trichloro-
• Aniline, 2-bromo-3,4,6-trichloro-
• 2-Bromo-3,4,6-trichlorobenzenamine