CAS 89466-07-9

4-Amino-3-nitrophenylboronic acid

Description:

4-Amino-3-nitrophenylboronic acid is an organic compound characterized by the presence of both an amino group and a nitro group attached to a phenyl ring, along with a boronic acid functional group. This compound typically appears as a solid and is soluble in polar solvents, such as water and alcohols, due to the presence of the boronic acid moiety, which can form hydrogen bonds. The amino group contributes to its basicity, while the nitro group introduces electron-withdrawing characteristics, influencing its reactivity and potential applications in organic synthesis and medicinal chemistry. It is often utilized in the development of sensors, drug delivery systems, and as a building block in the synthesis of more complex molecules. The boronic acid functionality allows for reversible covalent bonding with diols, making it valuable in various chemical reactions, including Suzuki coupling reactions. Safety data should be consulted, as with any chemical, to ensure proper handling and usage in laboratory settings.

Formula: C₆H₇BN₂O₄

InChI: InChI=1/C6H7BN2O4/c8-5-2-1-4(7(10)11)3-6(5)9(12)13/h1-3,10-11H,8H2

SMILES: c1cc(c(cc1B(O)O)N(=O)=O)N

Synonyms:

• (4-Amino-3-nitrophenyl)boronic acid
• boronic acid, B-(4-amino-3-nitrophenyl)-

4-Amino-3-nitrophenylboronicacid

CAS: 89466-07-9

Formula: C₆H₇BN₂O₄

Purity: 96%

Color and Shape: Solid

Molecular weight: 181.9418

Ref: IN-DA003KPT

4-Amino-3-nitrophenylboronic acid

CAS: 89466-07-9

4-Amino-3-nitrophenylboronic acid

Purity: 98%

Molecular weight: 181.94g/mol

Ref: 54-OR907475

(4-Amino-3-nitrophenyl)boronic acid

CAS: 89466-07-9

Formula: C₆H₇BN₂O₄

Purity: 97%

Molecular weight: 181.94

Ref: 10-F337977