CymitQuimica logo

CAS 89466-84-2

:

3H-spiro[1-benzofuran-2,3'-piperidine]

Description:
3H-spiro[1-benzofuran-2,3'-piperidine], identified by its CAS number 89466-84-2, is a chemical compound characterized by its unique spirocyclic structure, which consists of a benzofuran moiety fused to a piperidine ring. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the benzofuran unit suggests that it may engage in π-π stacking interactions and participate in hydrogen bonding, which can influence its solubility and reactivity. Additionally, the piperidine ring can provide basicity due to the nitrogen atom, which may play a role in its interaction with biological targets. Compounds of this type are often investigated for their pharmacological properties, including potential applications in medicinal chemistry. Overall, 3H-spiro[1-benzofuran-2,3'-piperidine] represents a structurally interesting compound that may exhibit diverse chemical behavior and biological activity, warranting further research into its applications.
Formula:C12H15NO
InChI:InChI=1/C12H15NO/c1-2-5-11-10(4-1)8-12(14-11)6-3-7-13-9-12/h1-2,4-5,13H,3,6-9H2
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.