
CAS 89473-81-4
:N-[1,1′-Biphenyl]-3-yl-4-morpholineacetamide
Description:
N-[1,1′-Biphenyl]-3-yl-4-morpholineacetamide, with the CAS number 89473-81-4, is a chemical compound characterized by its unique structure that includes a biphenyl moiety and a morpholine ring. This compound typically exhibits properties associated with amides, such as moderate solubility in polar solvents and potential biological activity due to its ability to interact with various biological targets. The presence of the morpholine group may contribute to its pharmacological properties, making it of interest in medicinal chemistry. Additionally, the biphenyl structure can influence its electronic properties and stability. As with many organic compounds, its reactivity can be influenced by the functional groups present, and it may participate in various chemical reactions, including acylation and substitution. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity. Overall, this compound's characteristics make it a subject of interest in research and development, particularly in the fields of pharmaceuticals and organic synthesis.
Formula:C18H20N2O2
InChI:InChI=1S/C18H20N2O2/c21-18(14-20-9-11-22-12-10-20)19-17-8-4-7-16(13-17)15-5-2-1-3-6-15/h1-8,13H,9-12,14H2,(H,19,21)
InChI key:InChIKey=UFCBLWXLIGSMAS-UHFFFAOYSA-N
SMILES:N(C(CN1CCOCC1)=O)C=2C=C(C=CC2)C3=CC=CC=C3
Synonyms:- 4-Morpholineacetamide, N-[1,1′-biphenyl]-3-yl-
- N-[1,1′-Biphenyl]-3-yl-4-morpholineacetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
