
CAS 89474-30-6
:2,3-Dihydro-N-2-naphthalenyl-1H-indole-1-acetamide
Description:
2,3-Dihydro-N-2-naphthalenyl-1H-indole-1-acetamide, with the CAS number 89474-30-6, is a chemical compound that belongs to the class of indole derivatives. This substance features a fused bicyclic structure, incorporating both indole and naphthalene moieties, which contribute to its unique chemical properties. The presence of the acetamide functional group indicates that it may exhibit biological activity, potentially influencing its solubility and reactivity. Typically, compounds of this nature are studied for their pharmacological properties, including potential applications in medicinal chemistry. The structural complexity of 2,3-Dihydro-N-2-naphthalenyl-1H-indole-1-acetamide may also suggest interesting interactions with biological targets, making it a subject of interest in drug discovery and development. Its physical properties, such as melting point, boiling point, and solubility, would be determined through experimental methods, and its safety profile would need to be assessed for any toxicological effects. Overall, this compound exemplifies the diverse chemistry found within indole derivatives and their potential utility in various scientific fields.
Formula:C20H18N2O
InChI:InChI=1S/C20H18N2O/c23-20(14-22-12-11-16-6-3-4-8-19(16)22)21-18-10-9-15-5-1-2-7-17(15)13-18/h1-10,13H,11-12,14H2,(H,21,23)
InChI key:InChIKey=FNTGWMJLZZQKFZ-UHFFFAOYSA-N
SMILES:C(C(NC1=CC2=C(C=C1)C=CC=C2)=O)N3C=4C(CC3)=CC=CC4
Synonyms:- 2,3-Dihydro-N-2-naphthalenyl-1H-indole-1-acetamide
- 2-(Indolin-1-yl)-N-(naphthalen-2-yl)acetamide
- 1H-Indole-1-acetamide, 2,3-dihydro-N-2-naphthalenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
