CAS 89478-08-0
:2-bromo-3-[(4-nitrophenyl)sulfanyl]naphthalene-1,4-dione
Description:
2-bromo-3-[(4-nitrophenyl)sulfanyl]naphthalene-1,4-dione is an organic compound characterized by its complex structure, which includes a naphthalene backbone substituted with a bromine atom and a 4-nitrophenyl sulfanyl group. This compound features a diketone functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of the bromine atom enhances its electrophilic character, making it a useful intermediate in various chemical reactions. Additionally, the nitro group on the phenyl ring introduces significant electron-withdrawing properties, which can influence the compound's reactivity and solubility in different solvents. The sulfanyl group may also participate in nucleophilic substitution reactions. Overall, this compound exhibits properties typical of halogenated and nitro-substituted aromatic compounds, including potential biological activity, making it of interest in medicinal chemistry and materials science. Its unique structural features allow for diverse applications in synthetic organic chemistry, particularly in the development of new pharmaceuticals or agrochemicals.
Formula:C16H8BrNO4S
InChI:InChI=1/C16H8BrNO4S/c17-13-14(19)11-3-1-2-4-12(11)15(20)16(13)23-10-7-5-9(6-8-10)18(21)22/h1-8H
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,4-Naphthalenedione,2-bromo-3-[(4-nitrophenyl)thio]-
CAS:Formula:C16H8BrNO4SMolecular weight:390.208
