
CAS 894791-47-0
:9-[1,1′-Biphenyl]-4-yl-3-iodo-9H-carbazole
Description:
9-[1,1′-Biphenyl]-4-yl-3-iodo-9H-carbazole, with the CAS number 894791-47-0, is an organic compound characterized by its complex structure that includes a carbazole core substituted with a biphenyl group and an iodine atom. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential for π-π stacking interactions due to its extended conjugated system. The presence of the iodine atom can influence its reactivity, making it a candidate for various chemical reactions, including electrophilic substitutions. Additionally, the biphenyl moiety may enhance its solubility in organic solvents and contribute to its electronic properties, which can be beneficial in applications such as organic electronics or photonic devices. The compound's unique structure may also impart specific optical properties, making it of interest in materials science and organic synthesis. Overall, 9-[1,1′-Biphenyl]-4-yl-3-iodo-9H-carbazole represents a versatile compound with potential applications in advanced materials and organic chemistry.
Formula:C24H16IN
InChI:InChI=1S/C24H16IN/c25-19-12-15-24-22(16-19)21-8-4-5-9-23(21)26(24)20-13-10-18(11-14-20)17-6-2-1-3-7-17/h1-16H
InChI key:InChIKey=KLKDSRMOQUCFFC-UHFFFAOYSA-N
SMILES:IC=1C=C2C(N(C=3C2=CC=CC3)C4=CC=C(C=C4)C5=CC=CC=C5)=CC1
Synonyms:- 9-(Biphenyl-4-yl)-3-iodocarbazole
- 9-[1,1′-Biphenyl]-4-yl-3-iodo-9H-carbazole
- 3-Iodo-9-(4-biphenylyl)carbazole
- 9H-Carbazole, 9-[1,1′-biphenyl]-4-yl-3-iodo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
