CAS 89482-27-9
:Glycine, N-(1,4,5,6-tetrahydro-4,6-dithioxo-1,3,5-triazin-2-yl)-
Description:
Glycine, N-(1,4,5,6-tetrahydro-4,6-dithioxo-1,3,5-triazin-2-yl)-, identified by CAS number 89482-27-9, is a chemical compound that features a glycine moiety linked to a triazine derivative. This compound is characterized by its unique structure, which includes a tetrahydrotriazine ring with two thiocarbonyl groups, contributing to its potential reactivity and biological activity. The presence of sulfur in the form of dithioxo groups may impart specific properties such as increased stability or unique interactions in biological systems. Glycine itself is the simplest amino acid, known for its role as a building block in proteins and its involvement in various metabolic processes. The combination of glycine with the triazine structure suggests potential applications in pharmaceuticals, agrochemicals, or as a biochemical probe. However, detailed studies on its specific properties, such as solubility, stability, and biological activity, would be necessary to fully understand its potential uses and implications in various fields.
Formula:C5H6N4O2S2
InChI:InChI=1S/C5H6N4O2S2/c10-2(11)1-6-3-7-4(12)9-5(13)8-3/h1H2,(H,10,11)(H3,6,7,8,9,12,13)
InChI key:InChIKey=JCMKAZJKWVLFMY-UHFFFAOYSA-N
SMILES:N(CC(O)=O)C=1NC(=S)NC(=S)N1
Synonyms:- 2-[(4,6-dithioxo-1H-1,3,5-triazin-2-yl)amino]acetic acid
- N-(1,4,5,6-Tetrahydro-4,6-dithioxo-1,3,5-triazin-2-yl)glycine
- Glycine, N-(1,4,5,6-tetrahydro-4,6-dithioxo-1,3,5-triazin-2-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Glycine,N-(1,4,5,6-tetrahydro-4,6-dithioxo-1,3,5-triazin-2-yl)- (9CI)
CAS:Formula:C5H6N4O2S2Molecular weight:218.2567
