CAS 89482-98-4
:{bis[4-(dimethylamino)phenyl]methylidene}propanedinitrile
Description:
{Bis[4-(dimethylamino)phenyl]methylidene}propanedinitrile, with the CAS number 89482-98-4, is an organic compound characterized by its complex structure featuring two dimethylamino groups attached to a central carbon framework. This compound typically exhibits properties associated with organic dyes and pigments, often displaying vibrant colors due to its conjugated system, which allows for effective light absorption. It is likely to be soluble in organic solvents, reflecting its non-polar characteristics, while being less soluble in water due to the presence of hydrophobic groups. The dimethylamino substituents can influence its electronic properties, making it a potential candidate for applications in dye-sensitized solar cells or as a colorant in various materials. Additionally, the presence of nitrile groups may impart certain reactivity, allowing for further chemical modifications. Safety data should be consulted, as compounds with similar structures can exhibit toxicity or environmental hazards. Overall, this compound's unique structural features contribute to its potential utility in various chemical and industrial applications.
Formula:C20H20N4
InChI:InChI=1/C20H20N4/c1-23(2)18-9-5-15(6-10-18)20(17(13-21)14-22)16-7-11-19(12-8-16)24(3)4/h5-12H,1-4H3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Propanedinitrile,2-[bis[4-(dimethylamino)phenyl]methylene]-
CAS:Formula:C20H20N4Molecular weight:316.3996
