CymitQuimica logo

CAS 894852-67-6

:

N-methyl-1-(3-methyl-1H-indol-2-yl)methanamine

Description:
N-methyl-1-(3-methyl-1H-indol-2-yl)methanamine, with the CAS number 894852-67-6, is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This substance features a methyl group attached to the nitrogen atom of the amine, enhancing its lipophilicity and potentially influencing its biological activity. The presence of the indole moiety suggests that it may exhibit properties similar to other indole derivatives, which are often involved in various biological processes and can act as neurotransmitter precursors or modulators. The compound's molecular structure indicates it may participate in hydrogen bonding due to the amine group, affecting its solubility and reactivity. Additionally, the methyl substitution on the indole ring can influence its electronic properties and steric hindrance, which may be relevant in pharmacological contexts. Overall, N-methyl-1-(3-methyl-1H-indol-2-yl)methanamine is of interest in medicinal chemistry and may have implications in drug development and research.
Formula:C11H14N2
InChI:InChI=1/C11H14N2/c1-8-9-5-3-4-6-10(9)13-11(8)7-12-2/h3-6,12-13H,7H2,1-2H3
SMILES:Cc1c2ccccc2[nH]c1CNC
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.