CAS 894854-15-0

2-Chloro-4-(2,5-dichlorophenyl)pyrimidine

Description:

2-Chloro-4-(2,5-dichlorophenyl)pyrimidine is a chemical compound characterized by its pyrimidine core, which is a six-membered heterocyclic ring containing two nitrogen atoms at positions 1 and 3. This compound features a chloro substituent at the 2-position and a 2,5-dichlorophenyl group at the 4-position, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of multiple chlorine atoms enhances its lipophilicity and may influence its biological activity, making it of interest in pharmaceutical research, particularly in the development of agrochemicals or medicinal compounds. The compound's structure suggests potential reactivity in nucleophilic substitution reactions due to the electrophilic nature of the chloro groups. Additionally, its molecular characteristics may allow for interactions with various biological targets, which could be explored in drug discovery contexts. Safety data should be consulted for handling and usage, as halogenated compounds can pose environmental and health risks.

Formula: C₁₀H₅Cl₃N₂

InChI: InChI=1S/C10H5Cl3N2/c11-6-1-2-8(12)7(5-6)9-3-4-14-10(13)15-9/h1-5H

InChI key: InChIKey=KFPPQQQRVPJYOZ-UHFFFAOYSA-N

SMILES: ClC1=C(C2=NC(Cl)=NC=C2)C=C(Cl)C=C1

Synonyms:

• Pyrimidine, 2-chloro-4-(2,5-dichlorophenyl)-
• 2-Chloro-4-(2,5-dichlorophenyl)pyrimidine