CAS 89487-73-0

2,3,4-Trichlorobenzenesulfonamide

Description:

2,3,4-Trichlorobenzenesulfonamide is an organic compound characterized by the presence of a sulfonamide functional group attached to a trichlorobenzene moiety. This compound features three chlorine atoms substituted on the benzene ring at the 2, 3, and 4 positions, which significantly influences its chemical properties, including increased reactivity and potential for various chemical interactions. The sulfonamide group contributes to its solubility in polar solvents and can participate in hydrogen bonding. Typically, compounds like 2,3,4-trichlorobenzenesulfonamide are of interest in various fields, including pharmaceuticals and agrochemicals, due to their biological activity and potential applications. The presence of chlorine atoms can enhance the compound's stability and lipophilicity, affecting its behavior in biological systems. Safety and handling considerations are important, as chlorinated compounds can pose environmental and health risks. Overall, this compound exemplifies the complexity of halogenated organic molecules and their diverse applications in chemical research and industry.

Formula: C₆H₄Cl₃NO₂S

InChI: InChI=1S/C6H4Cl3NO2S/c7-3-1-2-4(13(10,11)12)6(9)5(3)8/h1-2H,(H2,10,11,12)

InChI key: InChIKey=RRGFPRYWNRFCOR-UHFFFAOYSA-N

SMILES: S(N)(=O)(=O)C1=C(Cl)C(Cl)=C(Cl)C=C1

Synonyms:

• 2,3,4-Trichlorobenzene-1-sulfonamide
• Benzenesulfonamide, 2,3,4-trichloro-
• 2,3,4-Trichlorobenzenesulfonamide
• 2,3,4-Trichloro-benzenesulfonic acid amide