CAS 89488-06-2

6-amino-5-nitropyridine-3-carboxylic acid

Description:

6-Amino-5-nitropyridine-3-carboxylic acid is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features an amino group (-NH2) and a nitro group (-NO2) attached to the pyridine ring, as well as a carboxylic acid group (-COOH) at the 3-position. The presence of these functional groups contributes to its polar nature, making it soluble in polar solvents like water. The amino group can participate in hydrogen bonding, enhancing its reactivity and potential applications in organic synthesis. The nitro group is known for its electron-withdrawing properties, which can influence the compound's reactivity in electrophilic substitution reactions. This compound may be utilized in various fields, including pharmaceuticals and agrochemicals, due to its potential as a building block for more complex molecules. Its specific properties, such as melting point, boiling point, and spectral characteristics, would require experimental determination or reference to detailed chemical databases for precise values.

Formula: C₆H₅N₃O₄

InChI: InChI=1/C6H5N3O4/c7-5-4(9(12)13)1-3(2-8-5)6(10)11/h1-2H,(H2,7,8)(H,10,11)

SMILES: c1c(cnc(c1N(=O)=O)N)C(=O)O

Synonyms:

• 3-Pyridinecarboxylic Acid, 6-Amino-5-Nitro-
• 6-Amino-5-nitronicotinic acid

6-Amino-5-nitronicotinic acid

CAS: 89488-06-2

Formula: C₆H₅N₃O₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 183.1216

Ref: IN-DA0087RH

6-Amino-5-nitronicotinic acid

CAS: 89488-06-2

6-Amino-5-nitronicotinic acid

Purity: 95%

Molecular weight: 183.12g/mol

Ref: 54-OR91174

6-Amino-5-nitronicotinic acid

CAS: 89488-06-2

Formula: C₆H₅N₃O₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 183.123

Ref: 10-F232323

6-Amino-5-nitronicotinic acid

CAS: 89488-06-2

Versatile small molecule scaffold

Formula: C₆H₅N₃O₄

Purity: Min. 95%

Molecular weight: 183.12 g/mol

Ref: 3D-PDA48806