CAS 89488-57-3

1,4-Diiodo-2-nitrobenzene

Description:

1,4-Diiodo-2-nitrobenzene is an organic compound characterized by the presence of two iodine atoms and one nitro group attached to a benzene ring. The compound features a nitro group (-NO2) at the 2-position and iodine substituents at the 1 and 4 positions of the aromatic ring, which significantly influence its chemical properties and reactivity. It is typically a solid at room temperature and may exhibit a yellow to brown coloration. The presence of the iodine atoms enhances its electrophilic character, making it a useful intermediate in various organic synthesis reactions, particularly in the preparation of other functionalized aromatic compounds. Additionally, the nitro group contributes to the compound's electron-withdrawing properties, affecting its reactivity in nucleophilic substitution reactions. 1,4-Diiodo-2-nitrobenzene is also of interest in materials science and medicinal chemistry due to its potential applications in the development of dyes, pharmaceuticals, and agrochemicals. Safety precautions should be observed when handling this compound, as it may pose health risks upon exposure.

Formula: C₆H₃I₂NO₂

InChI: InChI=1/C6H3I2NO2/c7-4-1-2-5(8)6(3-4)9(10)11/h1-3H

SMILES: c1cc(c(cc1I)N(=O)=O)I

Synonyms:

• 1,4-Diiodo-2-nitro-benzene
• Benzene, 1,4-Diiodo-2-Nitro-

1,4-Diiodo-2-nitrobenzene

CAS: 89488-57-3

Formula: C₆H₃I₂NO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 374.9025

Ref: IN-DA0041SC

1,4-Diiodo-2-nitrobenzene

CAS: 89488-57-3

1,4-Diiodo-2-nitrobenzene

Purity: 98%

Molecular weight: 374.90g/mol

Ref: 54-OR79431

1,4-Diiodo-2-nitrobenzene

CAS: 89488-57-3

Purity: 98%

Molecular weight: 374.9039917

Ref: 10-F690050

1,4-Diiodo-2-nitrobenzene

CAS: 89488-57-3

Versatile small molecule scaffold

Formula: C₆H₃I₂NO₂

Purity: Min. 95%

Molecular weight: 374.9 g/mol

Ref: 3D-PDA48857