CAS 89498-91-9

6-hydroxy-11-methoxy-4,7b,9,12a-tetramethyl-3a,4a,5,6,7a,7b,8,8a,9,12a,12b,12c-dodecahydro[1,3]benzodioxolo[6,5,4-de]benzo[g]chromen-12(4H)-one

Description:

6-Hydroxy-11-methoxy-4,7b,9,12a-tetramethyl-3a,4a,5,6,7a,7b,8,8a,9,12a,12b,12c-dodecahydro[1,3]benzodioxolo[6,5,4-de]benzo[g]chromen-12(4H)-one, with CAS number 89498-91-9, is a complex organic compound characterized by its intricate polycyclic structure, which includes multiple fused rings and functional groups. This compound features hydroxyl (-OH) and methoxy (-OCH3) groups, contributing to its potential reactivity and solubility properties. The presence of multiple methyl groups enhances its hydrophobic characteristics, influencing its interaction with biological systems. Its structural complexity suggests potential applications in fields such as medicinal chemistry, where it may exhibit biological activity due to its unique arrangement of functional groups. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, this substance represents a fascinating example of synthetic organic chemistry with potential implications in pharmacology and material science.

Formula: C₂₂H₃₂O₆

InChI: InChI=1/C22H32O6/c1-10-6-14(25-5)20(24)22(4)12(10)7-15-21(3)13(8-16(23)28-15)11(2)17-18(19(21)22)27-9-26-17/h6,10-13,15-19,23H,7-9H2,1-5H3

SMILES: CC1C=C(C(=O)C2(C)C1CC1C3(C)C(CC(O)O1)C(C)C1C(C23)OCO1)OC

Picrasinol B

CAS: 89498-91-9

Formula: C₂₂H₃₂O₆

Purity: 95%~99%

Color and Shape: Powder

Molecular weight: 392.492

Ref: BP-SBP00834

Picrasinol B

CAS: 89498-91-9

Picrasinol B is a natural phenolic compound, which is derived from the bark of plants in the Picrasma genus. These plants are often found in tropical and subtropical regions and have been used in traditional medicine. Picrasinol B acts primarily through modulation of biological pathways associated with inflammation and oxidative stress. Its mode of action involves the inhibition of specific enzymes and signaling pathways, contributing to its antioxidant and anti-inflammatory effects.

Formula: C₂₂H₃₂O₆

Purity: Min. 95%

Molecular weight: 392.5 g/mol

Ref: 3D-PDA49891