
CAS 89499-34-3
:2-Thiophenecarboxylic acid, 4-amino-5-propyl-, hydrochloride (1:1)
Description:
2-Thiophenecarboxylic acid, 4-amino-5-propyl-, hydrochloride (1:1) is a chemical compound characterized by its thiophene ring structure, which is a five-membered aromatic heterocycle containing sulfur. This compound features a carboxylic acid functional group and an amino group, contributing to its potential as a building block in pharmaceuticals and organic synthesis. The presence of the propyl group enhances its hydrophobic characteristics, influencing its solubility and biological activity. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it easier to handle in laboratory and industrial settings. The compound may exhibit various biological activities, which can be attributed to the functional groups present, and it may serve as a precursor for further chemical modifications. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C8H11NO2S·ClH
InChI:InChI=1S/C8H11NO2S.ClH/c1-2-3-6-5(9)4-7(12-6)8(10)11;/h4H,2-3,9H2,1H3,(H,10,11);1H
InChI key:InChIKey=BTPZYTXDDARHEC-UHFFFAOYSA-N
SMILES:C(CC)C=1SC(C(O)=O)=CC1N.Cl
Synonyms:- 2-Thiophenecarboxylic acid, 4-amino-5-propyl-, hydrochloride (1:1)
- 2-Thiophenecarboxylic acid, 4-amino-5-propyl-, hydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Thiophenecarboxylic acid, 4-amino-5-propyl-, hydrochloride
CAS:Formula:C8H12ClNO2SMolecular weight:221.7044
