CAS 89499-38-7

4-Amino-2-thiophenecarboxylic acid

Description:

4-Amino-2-thiophenecarboxylic acid is an organic compound characterized by the presence of an amino group and a carboxylic acid functional group attached to a thiophene ring. This compound typically appears as a solid and is soluble in polar solvents due to its functional groups. The amino group (-NH2) contributes to its basicity, while the carboxylic acid group (-COOH) imparts acidic properties, allowing it to participate in various chemical reactions, such as amide formation and esterification. The thiophene ring, a five-membered aromatic heterocycle containing sulfur, enhances the compound's stability and can influence its electronic properties. This substance may be of interest in pharmaceutical and materials science applications, particularly in the synthesis of biologically active compounds or as a building block in organic synthesis. Its unique structure allows for potential interactions in biological systems, making it a candidate for further research in medicinal chemistry. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula: C₅H₅NO₂S

InChI: InChI=1S/C5H5NO2S/c6-3-1-4(5(7)8)9-2-3/h1-2H,6H2,(H,7,8)

InChI key: InChIKey=CQGOUQDVWSOUPD-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=CC(N)=CS1

Synonyms:

• 2-Thiophenecarboxylic Acid, 4-Amino-
• 4-Amino-2-thiophenecarboxylic acid

4-Aminothiophene-2-carboxylic acid

CAS: 89499-38-7

Formula: C₅H₅NO₂S

Purity: 97%

Molecular weight: 143.1637

Ref: IN-DA0041W8

4-Amino-2-thiophenecarboxylic Acid

Controlled Product

CAS: 89499-38-7

Formula: C₅H₅NO₂S

Color and Shape: Neat

Molecular weight: 143.164

Ref: TR-A630320