CAS 89499-42-3
:4-Amino-5-bromo-2-thiophenecarboxylic acid
Description:
4-Amino-5-bromo-2-thiophenecarboxylic acid is an organic compound characterized by its thiophene ring structure, which is a five-membered aromatic ring containing sulfur. This compound features an amino group (-NH2) and a carboxylic acid group (-COOH) that contribute to its reactivity and solubility in polar solvents. The presence of a bromine atom at the 5-position of the thiophene ring enhances its electrophilic properties, making it useful in various chemical reactions, including substitution reactions. The amino group can participate in hydrogen bonding, influencing its physical properties such as melting point and solubility. This compound is of interest in medicinal chemistry and materials science due to its potential applications in pharmaceuticals and as a building block for more complex organic molecules. Additionally, its unique structure may impart specific biological activities, making it a candidate for further research in drug development. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity and environmental impact.
Formula:C5H4BrNO2S
InChI:InChI=1S/C5H4BrNO2S/c6-4-2(7)1-3(10-4)5(8)9/h1H,7H2,(H,8,9)
InChI key:InChIKey=YYJRQBYVIMZIIX-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(N)=C(Br)S1
Synonyms:- 2-Thiophenecarboxylic acid, 4-amino-5-bromo-
- 4-Amino-5-bromo-2-thiophenecarboxylic acid
- 4-amino-5-bromothiophene-2-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
