
CAS 89499-45-6
:Methyl 4-amino-5-propyl-2-thiophenecarboxylate
Description:
Methyl 4-amino-5-propyl-2-thiophenecarboxylate is an organic compound characterized by its thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. This compound features an amino group (-NH2) and a propyl group attached to the thiophene ring, contributing to its unique chemical properties. The presence of the carboxylate group (-COOCH3) indicates that it is an ester, specifically a methyl ester, which can influence its reactivity and solubility in various solvents. Methyl 4-amino-5-propyl-2-thiophenecarboxylate may exhibit biological activity, making it of interest in pharmaceutical research. Its structure suggests potential applications in organic synthesis and materials science, particularly in the development of functionalized thiophene derivatives. The compound's CAS number, 89499-45-6, allows for easy identification and reference in chemical databases. Overall, this compound's unique functional groups and aromatic characteristics make it a subject of interest in both academic and industrial chemistry.
Formula:C9H13NO2S
InChI:InChI=1S/C9H13NO2S/c1-3-4-7-6(10)5-8(13-7)9(11)12-2/h5H,3-4,10H2,1-2H3
InChI key:InChIKey=IJUNHJZLLFDOHN-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1SC(CCC)=C(N)C1
Synonyms:- Methyl 4-amino-5-propyl-2-thiophenecarboxylate
- 2-Thiophenecarboxylic acid, 4-amino-5-propyl-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Thiophenecarboxylic acid, 4-amino-5-propyl-, methyl ester
CAS:Formula:C9H13NO2SMolecular weight:199.27
