CAS 89499-47-8

Ethyl 5-(acetylamino)-2-thiophenecarboxylate

Description:

Ethyl 5-(acetylamino)-2-thiophenecarboxylate is an organic compound characterized by its thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. This compound features an ethyl ester functional group and an acetylamino substituent, contributing to its reactivity and potential applications in organic synthesis. The presence of the acetylamino group suggests that it may participate in various chemical reactions, such as acylation or amidation. Ethyl 5-(acetylamino)-2-thiophenecarboxylate is likely to exhibit moderate solubility in organic solvents due to its ester and aromatic characteristics. Its structure may confer biological activity, making it of interest in medicinal chemistry for the development of pharmaceuticals. The compound's CAS number, 89499-47-8, allows for easy identification and retrieval of information in chemical databases. Overall, this compound's unique structural features and functional groups make it a valuable subject for further research in both synthetic and medicinal chemistry.

Formula: C₉H₁₁NO₃S

InChI: InChI=1S/C9H11NO3S/c1-3-13-9(12)7-4-5-8(14-7)10-6(2)11/h4-5H,3H2,1-2H3,(H,10,11)

InChI key: InChIKey=BWZJBVVCZYGVAK-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C=1SC(NC(C)=O)=CC1

Synonyms:

• 2-Thiophenecarboxylic acid, 5-acetamido-, ethyl ester
• Ethyl 5-(acetylamino)-2-thiophenecarboxylate
• 2-Thiophenecarboxylic acid, 5-(acetylamino)-, ethyl ester

2-Thiophenecarboxylic acid, 5-(acetylamino)-, ethyl ester

CAS: 89499-47-8

Formula: C₉H₁₁NO₃S

Molecular weight: 213.2535

Ref: IN-DA0041FR