CAS 895-80-7: 2,5-dibenzylidenecyclopentanone

Description:2,5-Dibenzylidenecyclopentanone is an organic compound characterized by its unique structure, which features a cyclopentanone core with two benzylidene groups attached at the 2 and 5 positions. This compound typically appears as a solid at room temperature and is known for its potential applications in organic synthesis and materials science. It exhibits properties such as moderate solubility in organic solvents and stability under standard conditions. The presence of the benzylidene groups contributes to its aromatic character, which can influence its reactivity and interaction with other chemical species. Additionally, 2,5-dibenzylidenecyclopentanone may exhibit interesting optical properties, making it a candidate for studies in photochemistry and photophysics. Its synthesis often involves condensation reactions, and it can serve as a precursor or intermediate in the preparation of more complex organic molecules. As with many organic compounds, handling should be done with care, considering potential toxicity and reactivity.

Formula:C₁₉H₁₆O

InChI:InChI=1/C19H16O/c20-19-17(13-15-7-3-1-4-8-15)11-12-18(19)14-16-9-5-2-6-10-16/h1-10,13-14H,11-12H2/b17-13-,18-14+

Synonyms:
Cyclopentanone, 2,5-bis(phenylmethylene)- (9CI)
Nsc 71885
Cyclopentanone, 2,5-dibenzylidene- (8CI)
(2E,5E)-2,5-bis(phenylmethylidene)cyclopentanone
(2Z,5E)-2,5-bis(phenylmethylidene)cyclopentanone

Found 4 products.

Product data	Purity	Price range	Estimated delivery
2,5-Dibenzylidenecyclopentanone REF: 3B-D3597CAS: 895-80-7	>98.0%(HPLC)	92.00 €~351.00 €	Fri 25 Apr 25
2,5-DIBENZYLIDENECYCLOPENTANONE REF: IN-DA003FWNCAS: 895-80-7	98%	55.00 €~301.00 €	Fri 02 May 25
2,5-Dibenzylidenecyclopentanone REF: 54-OR1029735CAS: 895-80-7	98%	32.00 €~1,270.00 €	Mon 05 May 25
2,5-Dibenzylidenecyclopentanone REF: 3D-AAA89580CAS: 895-80-7	Min. 95%	- - -	Discontinued product