CAS 89501-95-1

4-Chloro-2-[(phenylmethyl)thio]thiazole

Description:

4-Chloro-2-[(phenylmethyl)thio]thiazole is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. The presence of a chloro group at the 4-position and a phenylmethylthio group at the 2-position contributes to its unique chemical properties. This compound typically exhibits moderate to high lipophilicity due to the aromatic phenyl group, which can influence its solubility in organic solvents. It may also display biological activity, making it of interest in pharmaceutical research. The thiazole moiety is known for its role in various biological systems and can participate in diverse chemical reactions, including nucleophilic substitutions and electrophilic additions. Additionally, the compound's structure suggests potential reactivity with electrophiles due to the electron-withdrawing nature of the chloro substituent. Overall, 4-Chloro-2-[(phenylmethyl)thio]thiazole is a compound of interest in both synthetic organic chemistry and medicinal chemistry due to its structural features and potential applications.

Formula: C₁₀H₈ClNS₂

InChI: InChI=1S/C10H8ClNS2/c11-9-7-14-10(12-9)13-6-8-4-2-1-3-5-8/h1-5,7H,6H2

InChI key: InChIKey=UMUMWBQYKXVOSV-UHFFFAOYSA-N

SMILES: S(CC1=CC=CC=C1)C=2SC=C(Cl)N2

Synonyms:

• Thiazole, 4-chloro-2-[(phenylmethyl)thio]-
• 4-Chloro-2-[(phenylmethyl)thio]thiazole
• 2-(Benzylsulfanyl)-4-chloro-1,3-thiazole
• 2-(Benzylthio)-4-chlorothiazole

Thiazole, 4-chloro-2-[(phenylmethyl)thio]-

CAS: 89501-95-1

Formula: C₁₀H₈ClNS₂

Molecular weight: 241.7602

Ref: IN-DA0041OU