CymitQuimica logo

CAS 895010-30-7

:

5-(methoxymethyl)-4-(4-methoxyphenyl)-1H-pyrazol-3-amine

Description:
5-(Methoxymethyl)-4-(4-methoxyphenyl)-1H-pyrazol-3-amine is an organic compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features a methoxymethyl group and a para-methoxyphenyl substituent, contributing to its structural complexity and potential biological activity. The presence of the amine functional group suggests that it may engage in hydrogen bonding, influencing its solubility and reactivity. Typically, compounds of this nature are studied for their pharmacological properties, as modifications to the pyrazole structure can lead to diverse biological activities, including anti-inflammatory and analgesic effects. The methoxy groups enhance lipophilicity, potentially improving membrane permeability. Additionally, the compound's molecular structure may allow for various synthetic modifications, making it a candidate for further research in medicinal chemistry. As with many organic compounds, its stability, reactivity, and interactions with biological systems would be of interest in both academic and industrial contexts.
Formula:C12H15N3O2
InChI:InChI=1/C12H15N3O2/c1-16-7-10-11(12(13)15-14-10)8-3-5-9(17-2)6-4-8/h3-6H,7H2,1-2H3,(H3,13,14,15)
SMILES:COCc1c(c2ccc(cc2)OC)c(N)[nH]n1
Synonyms:
  • 1H-pyrazol-5-amine, 3-(methoxymethyl)-4-(4-methoxyphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.