CymitQuimica logo

CAS 895010-58-9

:

4-(2-methoxyphenyl)-3-methyl-1H-pyrazol-5-amine

Description:
4-(2-Methoxyphenyl)-3-methyl-1H-pyrazol-5-amine, with the CAS number 895010-58-9, is an organic compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features a methoxy-substituted phenyl group at one position and a methyl group at another, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The presence of the amine functional group suggests potential for hydrogen bonding, influencing its reactivity and interactions with other molecules. This compound may be of interest in medicinal chemistry and drug development due to its structural features, which could impart biological activity. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, including purification methods such as recrystallization or chromatography. Overall, 4-(2-methoxyphenyl)-3-methyl-1H-pyrazol-5-amine represents a versatile scaffold for further chemical exploration and potential applications in various fields.
Formula:C11H13N3O
InChI:InChI=1/C11H13N3O/c1-7-10(11(12)14-13-7)8-5-3-4-6-9(8)15-2/h3-6H,1-2H3,(H3,12,13,14)
SMILES:Cc1c(c2ccccc2OC)c(=N)[nH][nH]1
Synonyms:
  • 1H-pyrazol-5-amine, 4-(2-methoxyphenyl)-3-methyl-
  • 4-(2-Methoxyphenyl)-3-methyl-1H-pyrazol-5-amine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.