CAS 895042-78-1
:1-(4-Bromophenyl)-3-(1,1-dimethylethyl)-1H-pyrazol-5-amine
Description:
1-(4-Bromophenyl)-3-(1,1-dimethylethyl)-1H-pyrazol-5-amine, with the CAS number 895042-78-1, is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features a bromophenyl group at one position and a tert-butyl group at another, contributing to its unique properties. The presence of the bromine atom enhances its reactivity and potential for substitution reactions, while the tert-butyl group provides steric hindrance, influencing its interactions with other molecules. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Additionally, the compound's molecular structure suggests potential applications in various fields, including agrochemicals and materials science. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper precautions are taken.
Formula:C13H16BrN3
InChI:InChI=1S/C13H16BrN3/c1-13(2,3)11-8-12(15)17(16-11)10-6-4-9(14)5-7-10/h4-8H,15H2,1-3H3
InChI key:InChIKey=FCDQYVXCGSUWJN-UHFFFAOYSA-N
SMILES:NC=1N(N=C(C(C)(C)C)C1)C2=CC=C(Br)C=C2
Synonyms:- 1-(4-Bromophenyl)-3-(1,1-dimethylethyl)-1H-pyrazol-5-amine
- 1-(4-Bromophenyl)-3-tert-butyl-1H-pyrazol-5-amine
- 2-(4-Bromophenyl)-5-tert-butylpyrazol-3-amine
- [2-(4-Bromophenyl)-5-tert-butyl-2H-pyrazol-3-yl]amine
- 1H-Pyrazol-5-amine, 1-(4-bromophenyl)-3-(1,1-dimethylethyl)-
- 3-tert-Butyl-1-(4-bromophenyl)-1H-pyrazol-5-amine
- 2-(4-BROMO-PHENYL)-5-TERT-BUTYL-2H-PYRAZOL-3-YLAMINE
- JR-13715, 3-Tert-butyl-1-(4-bromophenyl)-1H-pyrazol-5-amine, 97%
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
