CAS 89510-90-7

2-chloro-5-fluoropyridin-4-amine

Description:

2-Chloro-5-fluoropyridin-4-amine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a chlorine atom at the 2-position and a fluorine atom at the 5-position, along with an amino group (-NH2) at the 4-position, contributes to its unique chemical properties. This compound is typically a solid at room temperature and is soluble in polar solvents, reflecting its polar functional groups. It exhibits basic properties due to the amino group, which can participate in hydrogen bonding and act as a nucleophile in various chemical reactions. The presence of halogens (chlorine and fluorine) can influence its reactivity, making it useful in medicinal chemistry and as an intermediate in the synthesis of pharmaceuticals. Additionally, the compound's structure allows for potential applications in agrochemicals and materials science. Safety data should be consulted for handling, as halogenated compounds can pose health risks.

Formula: C₅H₄ClFN₂

InChI: InChI=1/C5H4ClFN2/c6-5-1-4(8)3(7)2-9-5/h1-2H,(H2,8,9)

SMILES: c1c(c(cnc1Cl)F)N

Synonyms:

• 4-Pyridinamine, 2-Chloro-5-Fluoro-
• 4-Amino-2-Chloro-5-Fluoropyridine

2-Chloro-5-fluoro-4-pyridinamine

CAS: 89510-90-7

Formula: C₅H₄ClFN₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 146.5501

Ref: IN-DA0040SQ

4-Amino-2-chloro-5-fluoropyridine

CAS: 89510-90-7

4-Amino-2-chloro-5-fluoropyridine

Formula: C₅H₄ClFN₂

Purity: 95%

Color and Shape: light beige solid

Molecular weight: 146.55g/mol

Ref: 54-PC48311

2-Chloro-5-fluoropyridin-4-amine

CAS: 89510-90-7

Formula: C₅H₄ClFN₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 146.55

Ref: 10-F064852