CAS 895134-17-5

5-Bromo-3-methoxy-4-(phenylmethoxy)-2-pyridinemethanol

Description:

5-Bromo-3-methoxy-4-(phenylmethoxy)-2-pyridinemethanol is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with a bromine atom, a methoxy group, and a phenylmethoxy group. The presence of the bromine atom introduces a halogen, which can influence the compound's reactivity and biological activity. The methoxy groups enhance solubility and can participate in hydrogen bonding, while the phenylmethoxy moiety contributes to the compound's overall hydrophobic character. This compound may exhibit interesting pharmacological properties due to its structural features, making it a candidate for research in medicinal chemistry. Its molecular interactions can be influenced by the functional groups present, potentially affecting its binding affinity to biological targets. Additionally, the compound's stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 5-Bromo-3-methoxy-4-(phenylmethoxy)-2-pyridinemethanol represents a unique structure that may have applications in various fields, including drug development and organic synthesis.

Formula: C₁₄H₁₄BrNO₃

InChI: InChI=1S/C14H14BrNO3/c1-18-14-12(8-17)16-7-11(15)13(14)19-9-10-5-3-2-4-6-10/h2-7,17H,8-9H2,1H3

InChI key: InChIKey=NBHYGNVDMCKZMD-UHFFFAOYSA-N

SMILES: O(C)C=1C(OCC2=CC=CC=C2)=C(Br)C=NC1CO

Synonyms:

• (5-Bromo-3-methoxy-4-phenylmethoxypyridin-2-yl)methanol
• 2-Pyridinemethanol, 5-bromo-3-methoxy-4-(phenylmethoxy)-
• 5-Bromo-3-methoxy-4-(phenylmethoxy)-2-pyridinemethanol

(4-(BENZYLOXY)-5-BROMO-3-METHOXYPYRIDIN-2-YL)METHANOL

CAS: 895134-17-5

Formula: C₁₄H₁₄BrNO₃

Purity: 95.0%

Molecular weight: 324.174

Ref: 10-F530171