CAS 895155-78-9

(2,2,3,3-Tetramethylcyclopropyl)[1-(4,4,4-trifluorobutyl)-1H-indol-3-yl]methanone

Description:

(2,2,3,3-Tetramethylcyclopropyl)[1-(4,4,4-trifluorobutyl)-1H-indol-3-yl]methanone, with CAS number 895155-78-9, is a synthetic organic compound characterized by its complex structure that includes a cyclopropyl group and an indole moiety. The presence of the tetramethylcyclopropyl group contributes to its steric bulk, which can influence its reactivity and interactions with biological targets. The trifluorobutyl substituent enhances lipophilicity and may affect the compound's pharmacokinetic properties. This compound is likely to exhibit unique chemical behavior due to the combination of its functional groups, making it of interest in medicinal chemistry and drug development. Its potential applications may include roles as a pharmaceutical agent or in materials science, depending on its biological activity and stability. As with many synthetic compounds, understanding its solubility, stability under various conditions, and reactivity with other substances is crucial for its practical applications. Further studies would be necessary to elucidate its specific properties and potential uses in various fields.

Formula: C₂₀H₂₄F₃NO

InChI: InChI=1S/C20H24F3NO/c1-18(2)17(19(18,3)4)16(25)14-12-24(11-7-10-20(21,22)23)15-9-6-5-8-13(14)15/h5-6,8-9,12,17H,7,10-11H2,1-4H3

InChI key: InChIKey=PEXYKZYTXIEEOB-UHFFFAOYSA-N

SMILES: C(=O)(C1C(C)(C)C1(C)C)C=2C=3C(N(CCCC(F)(F)F)C2)=CC=CC3

Synonyms:

• (2,2,3,3-Tetramethylcyclopropyl)[1-(4,4,4-trifluorobutyl)-1H-indol-3-yl]methanone
• Methanone, (2,2,3,3-tetramethylcyclopropyl)[1-(4,4,4-trifluorobutyl)-1H-indol-3-yl]-
• XLR 12