CAS 89520-67-2

Benzenesulfinic acid, 4-propyl-, sodium salt (1:1)

Description:

Benzenesulfinic acid, 4-propyl-, sodium salt (1:1) is an organic compound characterized by the presence of a sulfinic acid functional group attached to a propyl-substituted benzene ring. This compound typically appears as a white to off-white solid and is soluble in water due to the ionic nature of the sodium salt. The sulfinic acid group imparts unique reactivity, making it useful in various chemical applications, including as a reducing agent or in the synthesis of other organic compounds. Its structure allows for potential interactions with biological systems, which may be explored in pharmaceutical or agrochemical contexts. The sodium salt form enhances its stability and solubility compared to the free acid. Safety data should be consulted for handling, as with all chemical substances, to ensure proper precautions are taken. Overall, benzenesulfinic acid, 4-propyl-, sodium salt is a versatile compound with applications in organic synthesis and potentially in various industrial processes.

Formula: C₉H₁₂O₂S·Na

InChI: InChI=1S/C9H12O2S.Na/c1-2-3-8-4-6-9(7-5-8)12(10)11;/h4-7H,2-3H2,1H3,(H,10,11);

InChI key: InChIKey=DPKPMCJOUZFORY-UHFFFAOYSA-N

SMILES: S(=O)(O)C1=CC=C(CCC)C=C1.[Na]

Synonyms:

• Benzenesulfinic acid, 4-propyl-, sodium salt
• Benzenesulfinic acid, 4-propyl-, sodium salt (1:1)

Sodium 4-propylbenzenesulfinate

CAS: 89520-67-2

Sodium 4-propylbenzenesulfinate

Purity: 97%

Molecular weight: 206.24g/mol

Ref: 54-OR1036164

Sodium 4-propylbenzenesulfinate

CAS: 89520-67-2

Purity: 97%

Molecular weight: 206.2299957

Ref: 10-F778995