CAS 89520-71-8

Benzenesulfinic acid, 2-bromo-, sodium salt (1:1)

Description:

Benzenesulfinic acid, 2-bromo-, sodium salt (1:1) is an organosulfur compound characterized by the presence of a sulfinic acid functional group attached to a brominated benzene ring. This compound typically appears as a white to off-white solid and is soluble in water due to the presence of the sodium salt. The sulfinic acid group (-SO2H) imparts acidic properties, while the bromine substituent can influence its reactivity and potential applications in organic synthesis. It is often used as a reagent in various chemical reactions, including nucleophilic substitutions and as an intermediate in the synthesis of other organic compounds. The presence of the sodium ion enhances its stability and solubility in aqueous environments. Safety data should be consulted, as with any chemical, to understand its handling and potential hazards. Overall, benzenesulfinic acid, 2-bromo-, sodium salt is a valuable compound in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals.

Formula: C₆H₅BrO₂S·Na

InChI: InChI=1S/C6H5BrO2S.Na/c7-5-3-1-2-4-6(5)10(8)9;/h1-4H,(H,8,9);

InChI key: InChIKey=WUGZYIYCFZIYHB-UHFFFAOYSA-N

SMILES: S(=O)(O)C1=C(Br)C=CC=C1.[Na]

Synonyms:

• Benzenesulfinic acid, 2-bromo-, sodium salt (1:1)
• Benzenesulfinic acid, 2-bromo-, sodium salt