CymitQuimica logo

CAS 89524-19-6

:

4-Penten-2-ol, 1,1,1-trifluoro-5-phenyl-, (E)-

Description:
4-Penten-2-ol, 1,1,1-trifluoro-5-phenyl-, (E)- is an organic compound characterized by its unique structure, which includes a pentene backbone with a hydroxyl group and a trifluoromethyl group. The presence of the trifluoromethyl group imparts distinctive electronic and steric properties, making it a valuable compound in various chemical applications, particularly in pharmaceuticals and agrochemicals. The (E)- configuration indicates that the highest priority substituents on either side of the double bond are on opposite sides, which can influence the compound's reactivity and interactions. This compound is likely to exhibit moderate polarity due to the hydroxyl group, affecting its solubility in polar solvents. Additionally, the phenyl group contributes to the compound's hydrophobic characteristics, influencing its overall behavior in different environments. As with many fluorinated compounds, it may exhibit unique thermal and chemical stability, making it of interest in materials science and synthetic chemistry. Safety and handling precautions should be observed due to potential toxicity associated with fluorinated organic compounds.
Formula:C11H11F3O
InChI:InChI=1/C11H11F3O/c12-11(13,14)10(15)8-4-7-9-5-2-1-3-6-9/h1-7,10,15H,8H2/b7-4+
InChI key:InChIKey=GFWBPEOMDFEILL-QPJJXVBHNA-N
SMILES:C(=C/CC(C(F)(F)F)O)\C1=CC=CC=C1
Synonyms:
  • 4-Penten-2-ol, 1,1,1-trifluoro-5-phenyl-, (E)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.