CAS 89524-98-1
:(+)-Boc-α-phosphonoglycine trimethyl ester
Description:
(+)-Boc-α-phosphonoglycine trimethyl ester is a chemical compound characterized by its unique structure, which includes a phosphonate group and a Boc (tert-butyloxycarbonyl) protecting group. This compound is typically used in organic synthesis and peptide chemistry, particularly for the preparation of phosphonated amino acids. The presence of the trimethyl ester moiety enhances its solubility and reactivity, making it suitable for various synthetic applications. The Boc group serves as a protective group for the amine functionality, allowing for selective reactions without interfering with other functional groups. This compound is often utilized in the development of pharmaceuticals and agrochemicals due to its ability to mimic natural amino acids while providing additional functionalities. Its stereochemistry, indicated by the (+) designation, suggests that it possesses a specific spatial arrangement that can influence its biological activity and interactions. Overall, (+)-Boc-α-phosphonoglycine trimethyl ester is a versatile intermediate in chemical synthesis with significant implications in medicinal chemistry.
Formula:C10H20NO7P
InChI:InChI=1/C10H20NO7P/c1-10(2,3)18-9(13)11-7(8(12)15-4)19(14,16-5)17-6/h7H,1-6H3,(H,11,13)/t7-/m1/s1
SMILES:CC(C)(C)OC(=N[C@@H](C(=O)OC)P(=O)(OC)OC)O
Synonyms:- Methyl [(Tert-Butoxycarbonyl)Amino](Dimethoxyphosphoryl)Acetate
- methyl (2S)-[(tert-butoxycarbonyl)amino](dimethoxyphosphoryl)ethanoate
- methyl (2R)-[(tert-butoxycarbonyl)amino](dimethoxyphosphoryl)ethanoate
- (+/-)-Boc-alpha-phosphonoglycine trimethyl ester
- Methyl N-Boc-2-(dimethylphosphono)glycinate
- Methyl 2-{[(Tert-Butoxy)Carbonyl]Amino}-2-(Dimethoxyphosphoryl)Acetate
- N-Boc-2-Phosphonoglycine trimethyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
N-(tert-Butoxycarbonyl)-2-phosphonoglycine Trimethyl Ester
CAS:Formula:C10H20NO7PPurity:>98.0%(HPLC)(N)Color and Shape:White to Almost white powder to crystalMolecular weight:297.24(+/-)-Boc-α-phosphonoglycine trimethyl ester, 95%
CAS:It is used as Wittig-Horner reagent for preparing (Z)-Boc-protected dehydroamino acid derivatives and saturated, unnatural amino acids by subsequent asymmetric hydrogenation. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation anFormula:C10H20NO7PPurity:95%Color and Shape:White to cream or pale yellow, PowderMolecular weight:297.24methyl 2-dimethoxyphosphoryl-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate
CAS:Formula:C10H20NO7PPurity:98%Color and Shape:SolidMolecular weight:297.2421(+/-)-Boc-α-phosphonoglycine trimethyl ester
CAS:(+/-)-Boc-α-phosphonoglycine trimethyl esterFormula:C10H20NO7PPurity:98%Color and Shape: white solidMolecular weight:297.24206g/mol(±)-Boc-a-phosphonoglycine Trimethyl Ester
CAS:Controlled ProductFormula:C10H20NO7PColor and Shape:NeatMolecular weight:297.24Boc-(+/-)-Phosphonoglycine trimethyl ester
CAS:Formula:C10H20NO7PPurity:98%Color and Shape:Solid, White powderMolecular weight:297.244(+/-)-BOC-a-phosphonoglycine tri-methyl ester
CAS:Reagent in the chemical synthesisFormula:C10H20NO7PPurity:Min. 95%Color and Shape:White PowderMolecular weight:297.24 g/mol







