CymitQuimica logo

CAS 895240-71-8

:

3-(3-Methoxypropoxy)-4-methylbenzoic acid

Description:
3-(3-Methoxypropoxy)-4-methylbenzoic acid, identified by its CAS number 895240-71-8, is an organic compound characterized by its benzoic acid structure modified with a methoxypropoxy group and a methyl substituent. This compound typically exhibits properties associated with both aromatic and aliphatic functionalities, which can influence its solubility, reactivity, and potential applications. The presence of the methoxy group enhances its hydrophobic characteristics, while the carboxylic acid group contributes to its acidity and potential for hydrogen bonding. Such compounds are often studied for their roles in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The specific arrangement of substituents can affect the compound's physical properties, such as melting point, boiling point, and solubility in various solvents. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. Overall, the unique structural features of 3-(3-Methoxypropoxy)-4-methylbenzoic acid contribute to its diverse chemical behavior and potential utility in various fields.
Formula:C12H16O4
InChI:InChI=1S/C12H16O4/c1-9-4-5-10(12(13)14)8-11(9)16-7-3-6-15-2/h4-5,8H,3,6-7H2,1-2H3,(H,13,14)
InChI key:InChIKey=NYHDRDMFVPDTCB-UHFFFAOYSA-N
SMILES:O(CCCOC)C1=CC(C(O)=O)=CC=C1C
Synonyms:
  • 4-Methyl-3-(3-methoxypropoxy)benzoic acid
  • Benzoic acid, 3-(3-methoxypropoxy)-4-methyl-
  • 3-(3-Methoxypropoxy)-4-methylbenzoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.